C9H6N4S2 — CID 5300057
2,5-dihydro-[1,2,4]triazolo[4,3-a]quinoxaline-1,4-dithione (PubChem CID 5300057) has the molecular formula C9H6N4S2 and a molecular weight of 234.31 g/mol. Its IUPAC name is 2,5-dihydro-[1,2,4]triazolo[4,3-a]quinoxaline-1,4-dithione.
| Compound Name | 2,5-dihydro-[1,2,4]triazolo[4,3-a]quinoxaline-1,4-dithione |
|---|---|
| PubChem CID | 5300057 |
| Molecular Formula | C9H6N4S2 |
| Molecular Weight | 234.31 g/mol |
| Exact Mass | 234.00 |
| IUPAC Name | 2,5-dihydro-[1,2,4]triazolo[4,3-a]quinoxaline-1,4-dithione |
| SMILES | S=c1[nH]c2ccccc2n2c(=S)[nH]nc12 |
| InChI | InChI=1S/C9H6N4S2/c14-8-7-11-12-9(15)13(7)6-4-2-1-3-5(6)10-8/h1-4H,(H,10,14)(H,12,15) |
| InChIKey | FYTBEPMFYXFJKF-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 48.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.31 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|