C23H21F3N2O — CID 5300061
(12-methyl-1,4-diazatetracyclo[7.6.1.05,16.010,15]hexadeca-9(16),10(15),11,13-tetraen-4-yl)-[4-(trifluoromethyl)phenyl]methanone (PubChem CID 5300061) has the molecular formula C23H21F3N2O and a molecular weight of 398.43 g/mol. Its IUPAC name is (12-methyl-1,4-diazatetracyclo[7.6.1.05,16.010,15]hexadeca-9(16),10(15),11,13-tetraen-4-yl)-[4-(trifluoromethyl)phenyl]methanone.
| Compound Name | (12-methyl-1,4-diazatetracyclo[7.6.1.05,16.010,15]hexadeca-9(16),10(15),11,13-tetraen-4-yl)-[4-(trifluoromethyl)phenyl]methanone |
|---|---|
| PubChem CID | 5300061 |
| Molecular Formula | C23H21F3N2O |
| Molecular Weight | 398.43 g/mol |
| Exact Mass | 398.16 |
| IUPAC Name | (12-methyl-1,4-diazatetracyclo[7.6.1.05,16.010,15]hexadeca-9(16),10(15),11,13-tetraen-4-yl)-[4-(trifluoromethyl)phenyl]methanone |
| SMILES | Cc1ccc2c(c1)c1c3n2CCN(C(=O)c2ccc(C(F)(F)F)cc2)C3CCC1 |
| InChI | InChI=1S/C23H21F3N2O/c1-14-5-10-19-18(13-14)17-3-2-4-20-21(17)27(19)11-12-28(20)22(29)15-6-8-16(9-7-15)23(24,25)26/h5-10,13,20H,2-4,11-12H2,1H3 |
| InChIKey | HZMXMQULQJDLNJ-UHFFFAOYSA-N |
| XLogP | 5.50 |
| TPSA | 25.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.43 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|