C22H17ClN2O2S — CID 53002190
4-(4-chlorophenyl)-N-(2-methoxyphenyl)-3-pyrrol-1-ylthiophene-2-carboxamide (PubChem CID 53002190) has the molecular formula C22H17ClN2O2S and a molecular weight of 408.91 g/mol. Its IUPAC name is 4-(4-chlorophenyl)-N-(2-methoxyphenyl)-3-pyrrol-1-ylthiophene-2-carboxamide.
| Compound Name | 4-(4-chlorophenyl)-N-(2-methoxyphenyl)-3-pyrrol-1-ylthiophene-2-carboxamide |
|---|---|
| PubChem CID | 53002190 |
| Molecular Formula | C22H17ClN2O2S |
| Molecular Weight | 408.91 g/mol |
| Exact Mass | 408.07 |
| IUPAC Name | 4-(4-chlorophenyl)-N-(2-methoxyphenyl)-3-pyrrol-1-ylthiophene-2-carboxamide |
| SMILES | COc1ccccc1NC(=O)c1scc(-c2ccc(Cl)cc2)c1-n1cccc1 |
| InChI | InChI=1S/C22H17ClN2O2S/c1-27-19-7-3-2-6-18(19)24-22(26)21-20(25-12-4-5-13-25)17(14-28-21)15-8-10-16(23)11-9-15/h2-14H,1H3,(H,24,26) |
| InChIKey | DZCMCGGSDMOQMS-UHFFFAOYSA-N |
| XLogP | 6.12 |
| TPSA | 43.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.91 |
| LogP ≤ 5 | 6.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |