C23H20N4O2 — CID 53002283
N-[(4-methoxyphenyl)methyl]-1-phenyl-5-pyridin-4-ylpyrazole-3-carboxamide (PubChem CID 53002283) has the molecular formula C23H20N4O2 and a molecular weight of 384.44 g/mol. Its IUPAC name is N-[(4-methoxyphenyl)methyl]-1-phenyl-5-pyridin-4-ylpyrazole-3-carboxamide.
| Compound Name | N-[(4-methoxyphenyl)methyl]-1-phenyl-5-pyridin-4-ylpyrazole-3-carboxamide |
|---|---|
| PubChem CID | 53002283 |
| Molecular Formula | C23H20N4O2 |
| Molecular Weight | 384.44 g/mol |
| Exact Mass | 384.16 |
| IUPAC Name | N-[(4-methoxyphenyl)methyl]-1-phenyl-5-pyridin-4-ylpyrazole-3-carboxamide |
| SMILES | COc1ccc(CNC(=O)c2cc(-c3ccncc3)n(-c3ccccc3)n2)cc1 |
| InChI | InChI=1S/C23H20N4O2/c1-29-20-9-7-17(8-10-20)16-25-23(28)21-15-22(18-11-13-24-14-12-18)27(26-21)19-5-3-2-4-6-19/h2-15H,16H2,1H3,(H,25,28) |
| InChIKey | LPKIQSUCMJVOAJ-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 69.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.44 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |