C22H26N4O — CID 53002630
6-methyl-4-[4-(piperidine-1-carbonyl)piperidin-1-yl]quinoline-3-carbonitrile (PubChem CID 53002630) has the molecular formula C22H26N4O and a molecular weight of 362.48 g/mol. Its IUPAC name is 6-methyl-4-[4-(piperidine-1-carbonyl)piperidin-1-yl]quinoline-3-carbonitrile.
| Compound Name | 6-methyl-4-[4-(piperidine-1-carbonyl)piperidin-1-yl]quinoline-3-carbonitrile |
|---|---|
| PubChem CID | 53002630 |
| Molecular Formula | C22H26N4O |
| Molecular Weight | 362.48 g/mol |
| Exact Mass | 362.21 |
| IUPAC Name | 6-methyl-4-[4-(piperidine-1-carbonyl)piperidin-1-yl]quinoline-3-carbonitrile |
| SMILES | Cc1ccc2ncc(C#N)c(N3CCC(C(=O)N4CCCCC4)CC3)c2c1 |
| InChI | InChI=1S/C22H26N4O/c1-16-5-6-20-19(13-16)21(18(14-23)15-24-20)25-11-7-17(8-12-25)22(27)26-9-3-2-4-10-26/h5-6,13,15,17H,2-4,7-12H2,1H3 |
| InChIKey | LQGCZQVIRMNADT-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 60.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.48 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |