About 7-ethyl-1,3-dimethyl-8-(4-propanoylphenoxy)purine-2,6-dione
7-ethyl-1,3-dimethyl-8-(4-propanoylphenoxy)purine-2,6-dione (PubChem CID 5300283) has the molecular formula C18H20N4O4
and a molecular weight of 356.38 g/mol. Its IUPAC name is 7-ethyl-1,3-dimethyl-8-(4-propanoylphenoxy)purine-2,6-dione.
Molecular Properties
| Compound Name | 7-ethyl-1,3-dimethyl-8-(4-propanoylphenoxy)purine-2,6-dione |
| PubChem CID | 5300283 |
| Molecular Formula | C18H20N4O4 |
| Molecular Weight | 356.38 g/mol |
| Exact Mass | 356.15 |
| IUPAC Name | 7-ethyl-1,3-dimethyl-8-(4-propanoylphenoxy)purine-2,6-dione |
| SMILES | CCC(=O)c1ccc(Oc2nc3c(c(=O)n(C)c(=O)n3C)n2CC)cc1 |
| InChI | InChI=1S/C18H20N4O4/c1-5-13(23)11-7-9-12(10-8-11)26-17-19-15-14(22(17)6-2)16(24)21(4)18(25)20(15)3/h7-10H,5-6H2,1-4H3 |
| InChIKey | FBNXZXZTDRYJKK-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 88.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 356.38 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
Analyze 7-ethyl-1,3-dimethyl-8-(4-propanoylphenoxy)purine-2,6-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-ethyl-1,3-dimethyl-8-(4-propanoylphenoxy)purine-2,6-dione?
The IUPAC name of 7-ethyl-1,3-dimethyl-8-(4-propanoylphenoxy)purine-2,6-dione (CID 5300283) is 7-ethyl-1,3-dimethyl-8-(4-propanoylphenoxy)purine-2,6-dione.
What is the SMILES notation for 7-ethyl-1,3-dimethyl-8-(4-propanoylphenoxy)purine-2,6-dione?
The canonical SMILES for 7-ethyl-1,3-dimethyl-8-(4-propanoylphenoxy)purine-2,6-dione is CCC(=O)c1ccc(Oc2nc3c(c(=O)n(C)c(=O)n3C)n2CC)cc1.
What is the InChIKey of 7-ethyl-1,3-dimethyl-8-(4-propanoylphenoxy)purine-2,6-dione?
The InChIKey is FBNXZXZTDRYJKK-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H20N4O4/c1-5-13(23)11-7-9-12(10-8-11)26-17-19-15-14(22(17)6-2)16(24)21(4)18(25)20(15)3/h7-10H,5-6H2,1-4H3.
What are the key properties of 7-ethyl-1,3-dimethyl-8-(4-propanoylphenoxy)purine-2,6-dione?
7-ethyl-1,3-dimethyl-8-(4-propanoylphenoxy)purine-2,6-dione has a molecular weight of 356.38 g/mol, XLogP of 1.84, 5 rotatable bonds, 0 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for 7-ethyl-1,3-dimethyl-8-(4-propanoylphenoxy)purine-2,6-dione is sourced from PubChem (CID 5300283), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).