C16H23N3O5S — CID 53004035
ethyl 4-[2-(cyclopropylcarbamoyl)pyrrolidin-1-yl]sulfonyl-1-methylpyrrole-2-carboxylate (PubChem CID 53004035) has the molecular formula C16H23N3O5S and a molecular weight of 369.44 g/mol. Its IUPAC name is ethyl 4-[2-(cyclopropylcarbamoyl)pyrrolidin-1-yl]sulfonyl-1-methylpyrrole-2-carboxylate.
| Compound Name | ethyl 4-[2-(cyclopropylcarbamoyl)pyrrolidin-1-yl]sulfonyl-1-methylpyrrole-2-carboxylate |
|---|---|
| PubChem CID | 53004035 |
| Molecular Formula | C16H23N3O5S |
| Molecular Weight | 369.44 g/mol |
| Exact Mass | 369.14 |
| IUPAC Name | ethyl 4-[2-(cyclopropylcarbamoyl)pyrrolidin-1-yl]sulfonyl-1-methylpyrrole-2-carboxylate |
| SMILES | CCOC(=O)c1cc(S(=O)(=O)N2CCCC2C(=O)NC2CC2)cn1C |
| InChI | InChI=1S/C16H23N3O5S/c1-3-24-16(21)14-9-12(10-18(14)2)25(22,23)19-8-4-5-13(19)15(20)17-11-6-7-11/h9-11,13H,3-8H2,1-2H3,(H,17,20) |
| InChIKey | UAVCVEKQEGYXAG-UHFFFAOYSA-N |
| XLogP | 0.63 |
| TPSA | 97.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.44 |
| LogP ≤ 5 | 0.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |