About 5,6-dimethyl-3-(3-morpholin-4-yl-3-oxopropyl)furo[2,3-d]pyrimidin-4-one
5,6-dimethyl-3-(3-morpholin-4-yl-3-oxopropyl)furo[2,3-d]pyrimidin-4-one (PubChem CID 53004435) has the molecular formula C15H19N3O4
and a molecular weight of 305.33 g/mol. Its IUPAC name is 5,6-dimethyl-3-(3-morpholin-4-yl-3-oxopropyl)furo[2,3-d]pyrimidin-4-one.
Molecular Properties
| Compound Name | 5,6-dimethyl-3-(3-morpholin-4-yl-3-oxopropyl)furo[2,3-d]pyrimidin-4-one |
| PubChem CID | 53004435 |
| Molecular Formula | C15H19N3O4 |
| Molecular Weight | 305.33 g/mol |
| Exact Mass | 305.14 |
| IUPAC Name | 5,6-dimethyl-3-(3-morpholin-4-yl-3-oxopropyl)furo[2,3-d]pyrimidin-4-one |
| SMILES | Cc1oc2ncn(CCC(=O)N3CCOCC3)c(=O)c2c1C |
| InChI | InChI=1S/C15H19N3O4/c1-10-11(2)22-14-13(10)15(20)18(9-16-14)4-3-12(19)17-5-7-21-8-6-17/h9H,3-8H2,1-2H3 |
| InChIKey | PWSAGGVYMHLVAZ-UHFFFAOYSA-N |
| XLogP | 0.86 |
| TPSA | 77.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 305.33 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 5,6-dimethyl-3-(3-morpholin-4-yl-3-oxopropyl)furo[2,3-d]pyrimidin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5,6-dimethyl-3-(3-morpholin-4-yl-3-oxopropyl)furo[2,3-d]pyrimidin-4-one?
The IUPAC name of 5,6-dimethyl-3-(3-morpholin-4-yl-3-oxopropyl)furo[2,3-d]pyrimidin-4-one (CID 53004435) is 5,6-dimethyl-3-(3-morpholin-4-yl-3-oxopropyl)furo[2,3-d]pyrimidin-4-one.
What is the SMILES notation for 5,6-dimethyl-3-(3-morpholin-4-yl-3-oxopropyl)furo[2,3-d]pyrimidin-4-one?
The canonical SMILES for 5,6-dimethyl-3-(3-morpholin-4-yl-3-oxopropyl)furo[2,3-d]pyrimidin-4-one is Cc1oc2ncn(CCC(=O)N3CCOCC3)c(=O)c2c1C.
What is the InChIKey of 5,6-dimethyl-3-(3-morpholin-4-yl-3-oxopropyl)furo[2,3-d]pyrimidin-4-one?
The InChIKey is PWSAGGVYMHLVAZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H19N3O4/c1-10-11(2)22-14-13(10)15(20)18(9-16-14)4-3-12(19)17-5-7-21-8-6-17/h9H,3-8H2,1-2H3.
What are the key properties of 5,6-dimethyl-3-(3-morpholin-4-yl-3-oxopropyl)furo[2,3-d]pyrimidin-4-one?
5,6-dimethyl-3-(3-morpholin-4-yl-3-oxopropyl)furo[2,3-d]pyrimidin-4-one has a molecular weight of 305.33 g/mol, XLogP of 0.86, 3 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 5,6-dimethyl-3-(3-morpholin-4-yl-3-oxopropyl)furo[2,3-d]pyrimidin-4-one is sourced from PubChem (CID 53004435), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).