C25H26FN3O2S — CID 53005060
7-fluoro-1'-(5,6,7,8-tetrahydronaphthalen-2-ylsulfonyl)spiro[5H-pyrrolo[1,2-a]quinoxaline-4,4'-piperidine] (PubChem CID 53005060) has the molecular formula C25H26FN3O2S and a molecular weight of 451.57 g/mol. Its IUPAC name is 7-fluoro-1'-(5,6,7,8-tetrahydronaphthalen-2-ylsulfonyl)spiro[5H-pyrrolo[1,2-a]quinoxaline-4,4'-piperidine].
| Compound Name | 7-fluoro-1'-(5,6,7,8-tetrahydronaphthalen-2-ylsulfonyl)spiro[5H-pyrrolo[1,2-a]quinoxaline-4,4'-piperidine] |
|---|---|
| PubChem CID | 53005060 |
| Molecular Formula | C25H26FN3O2S |
| Molecular Weight | 451.57 g/mol |
| Exact Mass | 451.17 |
| IUPAC Name | 7-fluoro-1'-(5,6,7,8-tetrahydronaphthalen-2-ylsulfonyl)spiro[5H-pyrrolo[1,2-a]quinoxaline-4,4'-piperidine] |
| SMILES | O=S(=O)(c1ccc2c(c1)CCCC2)N1CCC2(CC1)Nc1cc(F)ccc1-n1cccc12 |
| InChI | InChI=1S/C25H26FN3O2S/c26-20-8-10-23-22(17-20)27-25(24-6-3-13-29(23)24)11-14-28(15-12-25)32(30,31)21-9-7-18-4-1-2-5-19(18)16-21/h3,6-10,13,16-17,27H,1-2,4-5,11-12,14-15H2 |
| InChIKey | CKCRXZVNUPKLCJ-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 54.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.57 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |