C30H25N5O4 — CID 5300548
1'-ethyl-1-(2-methyl-5-nitrophenyl)-2',5-dioxo-2-pyrrol-1-ylspiro[7,8-dihydro-6H-quinoline-4,3'-indole]-3-carbonitrile (PubChem CID 5300548) has the molecular formula C30H25N5O4 and a molecular weight of 519.56 g/mol. Its IUPAC name is 1'-ethyl-1-(2-methyl-5-nitrophenyl)-2',5-dioxo-2-pyrrol-1-ylspiro[7,8-dihydro-6H-quinoline-4,3'-indole]-3-carbonitrile.
| Compound Name | 1'-ethyl-1-(2-methyl-5-nitrophenyl)-2',5-dioxo-2-pyrrol-1-ylspiro[7,8-dihydro-6H-quinoline-4,3'-indole]-3-carbonitrile |
|---|---|
| PubChem CID | 5300548 |
| Molecular Formula | C30H25N5O4 |
| Molecular Weight | 519.56 g/mol |
| Exact Mass | 519.19 |
| IUPAC Name | 1'-ethyl-1-(2-methyl-5-nitrophenyl)-2',5-dioxo-2-pyrrol-1-ylspiro[7,8-dihydro-6H-quinoline-4,3'-indole]-3-carbonitrile |
| SMILES | CCN1C(=O)C2(C(C#N)=C(n3cccc3)N(c3cc([N+](=O)[O-])ccc3C)C3=C2C(=O)CCC3)c2ccccc21 |
| InChI | InChI=1S/C30H25N5O4/c1-3-33-23-10-5-4-9-21(23)30(29(33)37)22(18-31)28(32-15-6-7-16-32)34(24-11-8-12-26(36)27(24)30)25-17-20(35(38)39)14-13-19(25)2/h4-7,9-10,13-17H,3,8,11-12H2,1-2H3 |
| InChIKey | ACWKTFVQPWSACH-UHFFFAOYSA-N |
| XLogP | 5.23 |
| TPSA | 112.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.56 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|