C22H18F2N6O4 — CID 53005644
N-(2,4-difluorophenyl)-3-[3-(4-ethyl-3,5-dioxo-2-phenyl-1,2,4-triazin-6-yl)-1,2,4-oxadiazol-5-yl]propanamide (PubChem CID 53005644) has the molecular formula C22H18F2N6O4 and a molecular weight of 468.42 g/mol. Its IUPAC name is N-(2,4-difluorophenyl)-3-[3-(4-ethyl-3,5-dioxo-2-phenyl-1,2,4-triazin-6-yl)-1,2,4-oxadiazol-5-yl]propanamide.
| Compound Name | N-(2,4-difluorophenyl)-3-[3-(4-ethyl-3,5-dioxo-2-phenyl-1,2,4-triazin-6-yl)-1,2,4-oxadiazol-5-yl]propanamide |
|---|---|
| PubChem CID | 53005644 |
| Molecular Formula | C22H18F2N6O4 |
| Molecular Weight | 468.42 g/mol |
| Exact Mass | 468.14 |
| IUPAC Name | N-(2,4-difluorophenyl)-3-[3-(4-ethyl-3,5-dioxo-2-phenyl-1,2,4-triazin-6-yl)-1,2,4-oxadiazol-5-yl]propanamide |
| SMILES | CCn1c(=O)c(-c2noc(CCC(=O)Nc3ccc(F)cc3F)n2)nn(-c2ccccc2)c1=O |
| InChI | InChI=1S/C22H18F2N6O4/c1-2-29-21(32)19(27-30(22(29)33)14-6-4-3-5-7-14)20-26-18(34-28-20)11-10-17(31)25-16-9-8-13(23)12-15(16)24/h3-9,12H,2,10-11H2,1H3,(H,25,31) |
| InChIKey | PLIKAELJFZULGV-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 124.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.42 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |