C15H8N4O3 — CID 5300573
1'-methyl-2,2',4-trioxospiro[3-azabicyclo[3.1.0]hexane-6,3'-indole]-1,5-dicarbonitrile (PubChem CID 5300573) has the molecular formula C15H8N4O3 and a molecular weight of 292.25 g/mol. Its IUPAC name is 1'-methyl-2,2',4-trioxospiro[3-azabicyclo[3.1.0]hexane-6,3'-indole]-1,5-dicarbonitrile.
| Compound Name | 1'-methyl-2,2',4-trioxospiro[3-azabicyclo[3.1.0]hexane-6,3'-indole]-1,5-dicarbonitrile |
|---|---|
| PubChem CID | 5300573 |
| Molecular Formula | C15H8N4O3 |
| Molecular Weight | 292.25 g/mol |
| Exact Mass | 292.06 |
| IUPAC Name | 1'-methyl-2,2',4-trioxospiro[3-azabicyclo[3.1.0]hexane-6,3'-indole]-1,5-dicarbonitrile |
| SMILES | CN1C(=O)C2(c3ccccc31)C1(C#N)C(=O)NC(=O)C12C#N |
| InChI | InChI=1S/C15H8N4O3/c1-19-9-5-3-2-4-8(9)15(12(19)22)13(6-16)10(20)18-11(21)14(13,15)7-17/h2-5H,1H3,(H,18,20,21) |
| InChIKey | XCDVULLZTDRVJW-UHFFFAOYSA-N |
| XLogP | -0.41 |
| TPSA | 114.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.25 |
| LogP ≤ 5 | -0.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|