C13H16N2O2S — CID 53006703
N,2,8-trimethyl-3a,4,5,8b-tetrahydrofuro[3,2-e][1,3]benzothiazole-7-carboxamide (PubChem CID 53006703) has the molecular formula C13H16N2O2S and a molecular weight of 264.35 g/mol. Its IUPAC name is N,2,8-trimethyl-3a,4,5,8b-tetrahydrofuro[3,2-e][1,3]benzothiazole-7-carboxamide.
| Compound Name | N,2,8-trimethyl-3a,4,5,8b-tetrahydrofuro[3,2-e][1,3]benzothiazole-7-carboxamide |
|---|---|
| PubChem CID | 53006703 |
| Molecular Formula | C13H16N2O2S |
| Molecular Weight | 264.35 g/mol |
| Exact Mass | 264.09 |
| IUPAC Name | N,2,8-trimethyl-3a,4,5,8b-tetrahydrofuro[3,2-e][1,3]benzothiazole-7-carboxamide |
| SMILES | CNC(=O)c1oc2c(c1C)C1N=C(C)SC1CC2 |
| InChI | InChI=1S/C13H16N2O2S/c1-6-10-8(17-12(6)13(16)14-3)4-5-9-11(10)15-7(2)18-9/h9,11H,4-5H2,1-3H3,(H,14,16) |
| InChIKey | XCTWZYABBYAEQT-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 54.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.35 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |