About 1-[(4-chloro-2-fluorophenyl)methyl]-4-(4-methoxyphenyl)-3H-1,5-benzodiazepin-2-one
1-[(4-chloro-2-fluorophenyl)methyl]-4-(4-methoxyphenyl)-3H-1,5-benzodiazepin-2-one (PubChem CID 53007656) has the molecular formula C23H18ClFN2O2
and a molecular weight of 408.86 g/mol. Its IUPAC name is 1-[(4-chloro-2-fluorophenyl)methyl]-4-(4-methoxyphenyl)-3H-1,5-benzodiazepin-2-one.
Molecular Properties
| Compound Name | 1-[(4-chloro-2-fluorophenyl)methyl]-4-(4-methoxyphenyl)-3H-1,5-benzodiazepin-2-one |
| PubChem CID | 53007656 |
| Molecular Formula | C23H18ClFN2O2 |
| Molecular Weight | 408.86 g/mol |
| Exact Mass | 408.10 |
| IUPAC Name | 1-[(4-chloro-2-fluorophenyl)methyl]-4-(4-methoxyphenyl)-3H-1,5-benzodiazepin-2-one |
| SMILES | COc1ccc(C2=Nc3ccccc3N(Cc3ccc(Cl)cc3F)C(=O)C2)cc1 |
| InChI | InChI=1S/C23H18ClFN2O2/c1-29-18-10-7-15(8-11-18)21-13-23(28)27(22-5-3-2-4-20(22)26-21)14-16-6-9-17(24)12-19(16)25/h2-12H,13-14H2,1H3 |
| InChIKey | ZQCRLAZGHHWNNK-UHFFFAOYSA-N |
| XLogP | 5.55 |
| TPSA | 41.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 408.86 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-[(4-chloro-2-fluorophenyl)methyl]-4-(4-methoxyphenyl)-3H-1,5-benzodiazepin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(4-chloro-2-fluorophenyl)methyl]-4-(4-methoxyphenyl)-3H-1,5-benzodiazepin-2-one?
The IUPAC name of 1-[(4-chloro-2-fluorophenyl)methyl]-4-(4-methoxyphenyl)-3H-1,5-benzodiazepin-2-one (CID 53007656) is 1-[(4-chloro-2-fluorophenyl)methyl]-4-(4-methoxyphenyl)-3H-1,5-benzodiazepin-2-one.
What is the SMILES notation for 1-[(4-chloro-2-fluorophenyl)methyl]-4-(4-methoxyphenyl)-3H-1,5-benzodiazepin-2-one?
The canonical SMILES for 1-[(4-chloro-2-fluorophenyl)methyl]-4-(4-methoxyphenyl)-3H-1,5-benzodiazepin-2-one is COc1ccc(C2=Nc3ccccc3N(Cc3ccc(Cl)cc3F)C(=O)C2)cc1.
What is the InChIKey of 1-[(4-chloro-2-fluorophenyl)methyl]-4-(4-methoxyphenyl)-3H-1,5-benzodiazepin-2-one?
The InChIKey is ZQCRLAZGHHWNNK-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H18ClFN2O2/c1-29-18-10-7-15(8-11-18)21-13-23(28)27(22-5-3-2-4-20(22)26-21)14-16-6-9-17(24)12-19(16)25/h2-12H,13-14H2,1H3.
What are the key properties of 1-[(4-chloro-2-fluorophenyl)methyl]-4-(4-methoxyphenyl)-3H-1,5-benzodiazepin-2-one?
1-[(4-chloro-2-fluorophenyl)methyl]-4-(4-methoxyphenyl)-3H-1,5-benzodiazepin-2-one has a molecular weight of 408.86 g/mol, XLogP of 5.55, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(4-chloro-2-fluorophenyl)methyl]-4-(4-methoxyphenyl)-3H-1,5-benzodiazepin-2-one is sourced from PubChem (CID 53007656), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).