C21H31N3O4S2 — CID 53008313
N-butyl-2-(2-methyl-4-oxo-7-piperidin-1-ylsulfonyl-2,3-dihydro-1,5-benzothiazepin-5-yl)acetamide (PubChem CID 53008313) has the molecular formula C21H31N3O4S2 and a molecular weight of 453.63 g/mol. Its IUPAC name is N-butyl-2-(2-methyl-4-oxo-7-piperidin-1-ylsulfonyl-2,3-dihydro-1,5-benzothiazepin-5-yl)acetamide.
| Compound Name | N-butyl-2-(2-methyl-4-oxo-7-piperidin-1-ylsulfonyl-2,3-dihydro-1,5-benzothiazepin-5-yl)acetamide |
|---|---|
| PubChem CID | 53008313 |
| Molecular Formula | C21H31N3O4S2 |
| Molecular Weight | 453.63 g/mol |
| Exact Mass | 453.18 |
| IUPAC Name | N-butyl-2-(2-methyl-4-oxo-7-piperidin-1-ylsulfonyl-2,3-dihydro-1,5-benzothiazepin-5-yl)acetamide |
| SMILES | CCCCNC(=O)CN1C(=O)CC(C)Sc2ccc(S(=O)(=O)N3CCCCC3)cc21 |
| InChI | InChI=1S/C21H31N3O4S2/c1-3-4-10-22-20(25)15-24-18-14-17(30(27,28)23-11-6-5-7-12-23)8-9-19(18)29-16(2)13-21(24)26/h8-9,14,16H,3-7,10-13,15H2,1-2H3,(H,22,25) |
| InChIKey | YRLVPGOWVFLJRV-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 86.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.63 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|