C24H23N5O — CID 53008666
N-[2-(cyclohexen-1-yl)ethyl]-2-(5-phenyl-1,3,4-oxadiazol-2-yl)quinazolin-4-amine (PubChem CID 53008666) has the molecular formula C24H23N5O and a molecular weight of 397.48 g/mol. Its IUPAC name is N-[2-(cyclohexen-1-yl)ethyl]-2-(5-phenyl-1,3,4-oxadiazol-2-yl)quinazolin-4-amine.
| Compound Name | N-[2-(cyclohexen-1-yl)ethyl]-2-(5-phenyl-1,3,4-oxadiazol-2-yl)quinazolin-4-amine |
|---|---|
| PubChem CID | 53008666 |
| Molecular Formula | C24H23N5O |
| Molecular Weight | 397.48 g/mol |
| Exact Mass | 397.19 |
| IUPAC Name | N-[2-(cyclohexen-1-yl)ethyl]-2-(5-phenyl-1,3,4-oxadiazol-2-yl)quinazolin-4-amine |
| SMILES | C1=C(CCNc2nc(-c3nnc(-c4ccccc4)o3)nc3ccccc23)CCCC1 |
| InChI | InChI=1S/C24H23N5O/c1-3-9-17(10-4-1)15-16-25-21-19-13-7-8-14-20(19)26-22(27-21)24-29-28-23(30-24)18-11-5-2-6-12-18/h2,5-9,11-14H,1,3-4,10,15-16H2,(H,25,26,27) |
| InChIKey | ABZYWMGLSZLYIM-UHFFFAOYSA-N |
| XLogP | 5.65 |
| TPSA | 76.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.48 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|