C26H35N3O5S — CID 53009431
ethyl 1,2,5-trimethyl-4-[4-(5,6,7,8-tetrahydronaphthalen-1-ylcarbamoyl)piperidin-1-yl]sulfonylpyrrole-3-carboxylate (PubChem CID 53009431) has the molecular formula C26H35N3O5S and a molecular weight of 501.65 g/mol. Its IUPAC name is ethyl 1,2,5-trimethyl-4-[4-(5,6,7,8-tetrahydronaphthalen-1-ylcarbamoyl)piperidin-1-yl]sulfonylpyrrole-3-carboxylate.
| Compound Name | ethyl 1,2,5-trimethyl-4-[4-(5,6,7,8-tetrahydronaphthalen-1-ylcarbamoyl)piperidin-1-yl]sulfonylpyrrole-3-carboxylate |
|---|---|
| PubChem CID | 53009431 |
| Molecular Formula | C26H35N3O5S |
| Molecular Weight | 501.65 g/mol |
| Exact Mass | 501.23 |
| IUPAC Name | ethyl 1,2,5-trimethyl-4-[4-(5,6,7,8-tetrahydronaphthalen-1-ylcarbamoyl)piperidin-1-yl]sulfonylpyrrole-3-carboxylate |
| SMILES | CCOC(=O)c1c(S(=O)(=O)N2CCC(C(=O)Nc3cccc4c3CCCC4)CC2)c(C)n(C)c1C |
| InChI | InChI=1S/C26H35N3O5S/c1-5-34-26(31)23-17(2)28(4)18(3)24(23)35(32,33)29-15-13-20(14-16-29)25(30)27-22-12-8-10-19-9-6-7-11-21(19)22/h8,10,12,20H,5-7,9,11,13-16H2,1-4H3,(H,27,30) |
| InChIKey | QIPRVPDHPWRZCZ-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 97.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.65 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |