About 1-(3-ethyl-1-methyl-2,6-dioxopyrimidin-4-yl)-N-(2-methoxyethyl)piperidine-3-carboxamide
1-(3-ethyl-1-methyl-2,6-dioxopyrimidin-4-yl)-N-(2-methoxyethyl)piperidine-3-carboxamide (PubChem CID 53010371) has the molecular formula C16H26N4O4
and a molecular weight of 338.41 g/mol. Its IUPAC name is 1-(3-ethyl-1-methyl-2,6-dioxopyrimidin-4-yl)-N-(2-methoxyethyl)piperidine-3-carboxamide.
Molecular Properties
| Compound Name | 1-(3-ethyl-1-methyl-2,6-dioxopyrimidin-4-yl)-N-(2-methoxyethyl)piperidine-3-carboxamide |
| PubChem CID | 53010371 |
| Molecular Formula | C16H26N4O4 |
| Molecular Weight | 338.41 g/mol |
| Exact Mass | 338.20 |
| IUPAC Name | 1-(3-ethyl-1-methyl-2,6-dioxopyrimidin-4-yl)-N-(2-methoxyethyl)piperidine-3-carboxamide |
| SMILES | CCn1c(N2CCCC(C(=O)NCCOC)C2)cc(=O)n(C)c1=O |
| InChI | InChI=1S/C16H26N4O4/c1-4-20-13(10-14(21)18(2)16(20)23)19-8-5-6-12(11-19)15(22)17-7-9-24-3/h10,12H,4-9,11H2,1-3H3,(H,17,22) |
| InChIKey | PIWRUOZNZAJTNH-UHFFFAOYSA-N |
| XLogP | -0.45 |
| TPSA | 85.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 338.41 |
| LogP ≤ 5 | -0.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 1-(3-ethyl-1-methyl-2,6-dioxopyrimidin-4-yl)-N-(2-methoxyethyl)piperidine-3-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(3-ethyl-1-methyl-2,6-dioxopyrimidin-4-yl)-N-(2-methoxyethyl)piperidine-3-carboxamide?
The IUPAC name of 1-(3-ethyl-1-methyl-2,6-dioxopyrimidin-4-yl)-N-(2-methoxyethyl)piperidine-3-carboxamide (CID 53010371) is 1-(3-ethyl-1-methyl-2,6-dioxopyrimidin-4-yl)-N-(2-methoxyethyl)piperidine-3-carboxamide.
What is the SMILES notation for 1-(3-ethyl-1-methyl-2,6-dioxopyrimidin-4-yl)-N-(2-methoxyethyl)piperidine-3-carboxamide?
The canonical SMILES for 1-(3-ethyl-1-methyl-2,6-dioxopyrimidin-4-yl)-N-(2-methoxyethyl)piperidine-3-carboxamide is CCn1c(N2CCCC(C(=O)NCCOC)C2)cc(=O)n(C)c1=O.
What is the InChIKey of 1-(3-ethyl-1-methyl-2,6-dioxopyrimidin-4-yl)-N-(2-methoxyethyl)piperidine-3-carboxamide?
The InChIKey is PIWRUOZNZAJTNH-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H26N4O4/c1-4-20-13(10-14(21)18(2)16(20)23)19-8-5-6-12(11-19)15(22)17-7-9-24-3/h10,12H,4-9,11H2,1-3H3,(H,17,22).
What are the key properties of 1-(3-ethyl-1-methyl-2,6-dioxopyrimidin-4-yl)-N-(2-methoxyethyl)piperidine-3-carboxamide?
1-(3-ethyl-1-methyl-2,6-dioxopyrimidin-4-yl)-N-(2-methoxyethyl)piperidine-3-carboxamide has a molecular weight of 338.41 g/mol, XLogP of -0.45, 6 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(3-ethyl-1-methyl-2,6-dioxopyrimidin-4-yl)-N-(2-methoxyethyl)piperidine-3-carboxamide is sourced from PubChem (CID 53010371), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).