C20H30N4O3 — CID 53010378
N-[2-(cyclohexen-1-yl)ethyl]-1-(1,3-dimethyl-2,6-dioxopyrimidin-4-yl)piperidine-3-carboxamide (PubChem CID 53010378) has the molecular formula C20H30N4O3 and a molecular weight of 374.49 g/mol. Its IUPAC name is N-[2-(cyclohexen-1-yl)ethyl]-1-(1,3-dimethyl-2,6-dioxopyrimidin-4-yl)piperidine-3-carboxamide.
| Compound Name | N-[2-(cyclohexen-1-yl)ethyl]-1-(1,3-dimethyl-2,6-dioxopyrimidin-4-yl)piperidine-3-carboxamide |
|---|---|
| PubChem CID | 53010378 |
| Molecular Formula | C20H30N4O3 |
| Molecular Weight | 374.49 g/mol |
| Exact Mass | 374.23 |
| IUPAC Name | N-[2-(cyclohexen-1-yl)ethyl]-1-(1,3-dimethyl-2,6-dioxopyrimidin-4-yl)piperidine-3-carboxamide |
| SMILES | Cn1c(N2CCCC(C(=O)NCCC3=CCCCC3)C2)cc(=O)n(C)c1=O |
| InChI | InChI=1S/C20H30N4O3/c1-22-17(13-18(25)23(2)20(22)27)24-12-6-9-16(14-24)19(26)21-11-10-15-7-4-3-5-8-15/h7,13,16H,3-6,8-12,14H2,1-2H3,(H,21,26) |
| InChIKey | BIOGEKLZTHGWMM-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 76.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.49 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|