C15H24N4O4 — CID 53010384
1-(1,3-dimethyl-2,6-dioxopyrimidin-4-yl)-N-(2-methoxyethyl)piperidine-3-carboxamide (PubChem CID 53010384) has the molecular formula C15H24N4O4 and a molecular weight of 324.38 g/mol. Its IUPAC name is 1-(1,3-dimethyl-2,6-dioxopyrimidin-4-yl)-N-(2-methoxyethyl)piperidine-3-carboxamide.
| Compound Name | 1-(1,3-dimethyl-2,6-dioxopyrimidin-4-yl)-N-(2-methoxyethyl)piperidine-3-carboxamide |
|---|---|
| PubChem CID | 53010384 |
| Molecular Formula | C15H24N4O4 |
| Molecular Weight | 324.38 g/mol |
| Exact Mass | 324.18 |
| IUPAC Name | 1-(1,3-dimethyl-2,6-dioxopyrimidin-4-yl)-N-(2-methoxyethyl)piperidine-3-carboxamide |
| SMILES | COCCNC(=O)C1CCCN(c2cc(=O)n(C)c(=O)n2C)C1 |
| InChI | InChI=1S/C15H24N4O4/c1-17-12(9-13(20)18(2)15(17)22)19-7-4-5-11(10-19)14(21)16-6-8-23-3/h9,11H,4-8,10H2,1-3H3,(H,16,21) |
| InChIKey | OMXIDTDMIGZYHW-UHFFFAOYSA-N |
| XLogP | -0.94 |
| TPSA | 85.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.38 |
| LogP ≤ 5 | -0.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|