C20H34N6O3 — CID 53010393
1-(1,3-dimethyl-2,6-dioxopyrimidin-4-yl)-N-[3-(4-methylpiperazin-1-yl)propyl]piperidine-3-carboxamide (PubChem CID 53010393) has the molecular formula C20H34N6O3 and a molecular weight of 406.53 g/mol. Its IUPAC name is 1-(1,3-dimethyl-2,6-dioxopyrimidin-4-yl)-N-[3-(4-methylpiperazin-1-yl)propyl]piperidine-3-carboxamide.
| Compound Name | 1-(1,3-dimethyl-2,6-dioxopyrimidin-4-yl)-N-[3-(4-methylpiperazin-1-yl)propyl]piperidine-3-carboxamide |
|---|---|
| PubChem CID | 53010393 |
| Molecular Formula | C20H34N6O3 |
| Molecular Weight | 406.53 g/mol |
| Exact Mass | 406.27 |
| IUPAC Name | 1-(1,3-dimethyl-2,6-dioxopyrimidin-4-yl)-N-[3-(4-methylpiperazin-1-yl)propyl]piperidine-3-carboxamide |
| SMILES | CN1CCN(CCCNC(=O)C2CCCN(c3cc(=O)n(C)c(=O)n3C)C2)CC1 |
| InChI | InChI=1S/C20H34N6O3/c1-22-10-12-25(13-11-22)8-5-7-21-19(28)16-6-4-9-26(15-16)17-14-18(27)24(3)20(29)23(17)2/h14,16H,4-13,15H2,1-3H3,(H,21,28) |
| InChIKey | MEWOPDAJWXGSMG-UHFFFAOYSA-N |
| XLogP | -0.95 |
| TPSA | 82.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.53 |
| LogP ≤ 5 | -0.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|