About 2-(4-iodo-3,5-dimethylpyrazol-1-yl)-N-(5-nitro-1,3-thiazol-2-yl)acetamide
2-(4-iodo-3,5-dimethylpyrazol-1-yl)-N-(5-nitro-1,3-thiazol-2-yl)acetamide (PubChem CID 5301041) has the molecular formula C10H10IN5O3S
and a molecular weight of 407.19 g/mol. Its IUPAC name is 2-(4-iodo-3,5-dimethylpyrazol-1-yl)-N-(5-nitro-1,3-thiazol-2-yl)acetamide.
Molecular Properties
| Compound Name | 2-(4-iodo-3,5-dimethylpyrazol-1-yl)-N-(5-nitro-1,3-thiazol-2-yl)acetamide |
| PubChem CID | 5301041 |
| Molecular Formula | C10H10IN5O3S |
| Molecular Weight | 407.19 g/mol |
| Exact Mass | 406.95 |
| IUPAC Name | 2-(4-iodo-3,5-dimethylpyrazol-1-yl)-N-(5-nitro-1,3-thiazol-2-yl)acetamide |
| SMILES | Cc1nn(CC(=O)Nc2ncc([N+](=O)[O-])s2)c(C)c1I |
| InChI | InChI=1S/C10H10IN5O3S/c1-5-9(11)6(2)15(14-5)4-7(17)13-10-12-3-8(20-10)16(18)19/h3H,4H2,1-2H3,(H,12,13,17) |
| InChIKey | PBZVRNLLGRZCTQ-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 102.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 407.19 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-(4-iodo-3,5-dimethylpyrazol-1-yl)-N-(5-nitro-1,3-thiazol-2-yl)acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(4-iodo-3,5-dimethylpyrazol-1-yl)-N-(5-nitro-1,3-thiazol-2-yl)acetamide?
The IUPAC name of 2-(4-iodo-3,5-dimethylpyrazol-1-yl)-N-(5-nitro-1,3-thiazol-2-yl)acetamide (CID 5301041) is 2-(4-iodo-3,5-dimethylpyrazol-1-yl)-N-(5-nitro-1,3-thiazol-2-yl)acetamide.
What is the SMILES notation for 2-(4-iodo-3,5-dimethylpyrazol-1-yl)-N-(5-nitro-1,3-thiazol-2-yl)acetamide?
The canonical SMILES for 2-(4-iodo-3,5-dimethylpyrazol-1-yl)-N-(5-nitro-1,3-thiazol-2-yl)acetamide is Cc1nn(CC(=O)Nc2ncc([N+](=O)[O-])s2)c(C)c1I.
What is the InChIKey of 2-(4-iodo-3,5-dimethylpyrazol-1-yl)-N-(5-nitro-1,3-thiazol-2-yl)acetamide?
The InChIKey is PBZVRNLLGRZCTQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H10IN5O3S/c1-5-9(11)6(2)15(14-5)4-7(17)13-10-12-3-8(20-10)16(18)19/h3H,4H2,1-2H3,(H,12,13,17).
What are the key properties of 2-(4-iodo-3,5-dimethylpyrazol-1-yl)-N-(5-nitro-1,3-thiazol-2-yl)acetamide?
2-(4-iodo-3,5-dimethylpyrazol-1-yl)-N-(5-nitro-1,3-thiazol-2-yl)acetamide has a molecular weight of 407.19 g/mol, XLogP of 2.11, 4 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4-iodo-3,5-dimethylpyrazol-1-yl)-N-(5-nitro-1,3-thiazol-2-yl)acetamide is sourced from PubChem (CID 5301041), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).