About 2-[4-(dimethylamino)phenyl]-N-(3-methoxypropyl)imidazo[2,1-b][1,3]benzothiazol-1-amine
2-[4-(dimethylamino)phenyl]-N-(3-methoxypropyl)imidazo[2,1-b][1,3]benzothiazol-1-amine (PubChem CID 53010641) has the molecular formula C21H24N4OS
and a molecular weight of 380.52 g/mol. Its IUPAC name is 2-[4-(dimethylamino)phenyl]-N-(3-methoxypropyl)imidazo[2,1-b][1,3]benzothiazol-1-amine.
Molecular Properties
| Compound Name | 2-[4-(dimethylamino)phenyl]-N-(3-methoxypropyl)imidazo[2,1-b][1,3]benzothiazol-1-amine |
| PubChem CID | 53010641 |
| Molecular Formula | C21H24N4OS |
| Molecular Weight | 380.52 g/mol |
| Exact Mass | 380.17 |
| IUPAC Name | 2-[4-(dimethylamino)phenyl]-N-(3-methoxypropyl)imidazo[2,1-b][1,3]benzothiazol-1-amine |
| SMILES | COCCCNc1c(-c2ccc(N(C)C)cc2)nc2sc3ccccc3n12 |
| InChI | InChI=1S/C21H24N4OS/c1-24(2)16-11-9-15(10-12-16)19-20(22-13-6-14-26-3)25-17-7-4-5-8-18(17)27-21(25)23-19/h4-5,7-12,22H,6,13-14H2,1-3H3 |
| InChIKey | SBYGOVHOINPZAI-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 41.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 380.52 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-[4-(dimethylamino)phenyl]-N-(3-methoxypropyl)imidazo[2,1-b][1,3]benzothiazol-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[4-(dimethylamino)phenyl]-N-(3-methoxypropyl)imidazo[2,1-b][1,3]benzothiazol-1-amine?
The IUPAC name of 2-[4-(dimethylamino)phenyl]-N-(3-methoxypropyl)imidazo[2,1-b][1,3]benzothiazol-1-amine (CID 53010641) is 2-[4-(dimethylamino)phenyl]-N-(3-methoxypropyl)imidazo[2,1-b][1,3]benzothiazol-1-amine.
What is the SMILES notation for 2-[4-(dimethylamino)phenyl]-N-(3-methoxypropyl)imidazo[2,1-b][1,3]benzothiazol-1-amine?
The canonical SMILES for 2-[4-(dimethylamino)phenyl]-N-(3-methoxypropyl)imidazo[2,1-b][1,3]benzothiazol-1-amine is COCCCNc1c(-c2ccc(N(C)C)cc2)nc2sc3ccccc3n12.
What is the InChIKey of 2-[4-(dimethylamino)phenyl]-N-(3-methoxypropyl)imidazo[2,1-b][1,3]benzothiazol-1-amine?
The InChIKey is SBYGOVHOINPZAI-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H24N4OS/c1-24(2)16-11-9-15(10-12-16)19-20(22-13-6-14-26-3)25-17-7-4-5-8-18(17)27-21(25)23-19/h4-5,7-12,22H,6,13-14H2,1-3H3.
What are the key properties of 2-[4-(dimethylamino)phenyl]-N-(3-methoxypropyl)imidazo[2,1-b][1,3]benzothiazol-1-amine?
2-[4-(dimethylamino)phenyl]-N-(3-methoxypropyl)imidazo[2,1-b][1,3]benzothiazol-1-amine has a molecular weight of 380.52 g/mol, XLogP of 4.73, 7 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[4-(dimethylamino)phenyl]-N-(3-methoxypropyl)imidazo[2,1-b][1,3]benzothiazol-1-amine is sourced from PubChem (CID 53010641), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).