C22H25FN2O2S — CID 53011180
N-[(3-fluorophenyl)methyl]-3-methyl-1-(2-phenylsulfanylacetyl)piperidine-3-carboxamide (PubChem CID 53011180) has the molecular formula C22H25FN2O2S and a molecular weight of 400.52 g/mol. Its IUPAC name is N-[(3-fluorophenyl)methyl]-3-methyl-1-(2-phenylsulfanylacetyl)piperidine-3-carboxamide.
| Compound Name | N-[(3-fluorophenyl)methyl]-3-methyl-1-(2-phenylsulfanylacetyl)piperidine-3-carboxamide |
|---|---|
| PubChem CID | 53011180 |
| Molecular Formula | C22H25FN2O2S |
| Molecular Weight | 400.52 g/mol |
| Exact Mass | 400.16 |
| IUPAC Name | N-[(3-fluorophenyl)methyl]-3-methyl-1-(2-phenylsulfanylacetyl)piperidine-3-carboxamide |
| SMILES | CC1(C(=O)NCc2cccc(F)c2)CCCN(C(=O)CSc2ccccc2)C1 |
| InChI | InChI=1S/C22H25FN2O2S/c1-22(21(27)24-14-17-7-5-8-18(23)13-17)11-6-12-25(16-22)20(26)15-28-19-9-3-2-4-10-19/h2-5,7-10,13H,6,11-12,14-16H2,1H3,(H,24,27) |
| InChIKey | WKHMCOAZCZTQHX-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.52 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |