C24H28N4O3 — CID 53011384
N-[2-(dimethylamino)ethyl]-2-[(6,11-dioxo-6a,7,8,9-tetrahydropyrrolo[2,1-c][1,4]benzodiazepin-5-yl)methyl]benzamide (PubChem CID 53011384) has the molecular formula C24H28N4O3 and a molecular weight of 420.51 g/mol. Its IUPAC name is N-[2-(dimethylamino)ethyl]-2-[(6,11-dioxo-6a,7,8,9-tetrahydropyrrolo[2,1-c][1,4]benzodiazepin-5-yl)methyl]benzamide.
| Compound Name | N-[2-(dimethylamino)ethyl]-2-[(6,11-dioxo-6a,7,8,9-tetrahydropyrrolo[2,1-c][1,4]benzodiazepin-5-yl)methyl]benzamide |
|---|---|
| PubChem CID | 53011384 |
| Molecular Formula | C24H28N4O3 |
| Molecular Weight | 420.51 g/mol |
| Exact Mass | 420.22 |
| IUPAC Name | N-[2-(dimethylamino)ethyl]-2-[(6,11-dioxo-6a,7,8,9-tetrahydropyrrolo[2,1-c][1,4]benzodiazepin-5-yl)methyl]benzamide |
| SMILES | CN(C)CCNC(=O)c1ccccc1CN1C(=O)C2CCCN2C(=O)c2ccccc21 |
| InChI | InChI=1S/C24H28N4O3/c1-26(2)15-13-25-22(29)18-9-4-3-8-17(18)16-28-20-11-6-5-10-19(20)23(30)27-14-7-12-21(27)24(28)31/h3-6,8-11,21H,7,12-16H2,1-2H3,(H,25,29) |
| InChIKey | YEKPUXOUKCCMDB-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 72.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.51 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |