C21H21N5O2 — CID 53012971
N-(3-methoxypropyl)-2-[5-(3-methylphenyl)-1,3,4-oxadiazol-2-yl]quinazolin-4-amine (PubChem CID 53012971) has the molecular formula C21H21N5O2 and a molecular weight of 375.43 g/mol. Its IUPAC name is N-(3-methoxypropyl)-2-[5-(3-methylphenyl)-1,3,4-oxadiazol-2-yl]quinazolin-4-amine.
| Compound Name | N-(3-methoxypropyl)-2-[5-(3-methylphenyl)-1,3,4-oxadiazol-2-yl]quinazolin-4-amine |
|---|---|
| PubChem CID | 53012971 |
| Molecular Formula | C21H21N5O2 |
| Molecular Weight | 375.43 g/mol |
| Exact Mass | 375.17 |
| IUPAC Name | N-(3-methoxypropyl)-2-[5-(3-methylphenyl)-1,3,4-oxadiazol-2-yl]quinazolin-4-amine |
| SMILES | COCCCNc1nc(-c2nnc(-c3cccc(C)c3)o2)nc2ccccc12 |
| InChI | InChI=1S/C21H21N5O2/c1-14-7-5-8-15(13-14)20-25-26-21(28-20)19-23-17-10-4-3-9-16(17)18(24-19)22-11-6-12-27-2/h3-5,7-10,13H,6,11-12H2,1-2H3,(H,22,23,24) |
| InChIKey | DFTHZLGGGBKOIS-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 85.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.43 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|