C16H23NO3 — CID 53013452
(1R,3R,6R,7R,9S)-9-(2,6-dimethylpiperidine-1-carbonyl)-4-oxatricyclo[4.2.1.03,7]nonan-5-one (PubChem CID 53013452) has the molecular formula C16H23NO3 and a molecular weight of 277.36 g/mol. Its IUPAC name is (1R,3R,6R,7R,9S)-9-(2,6-dimethylpiperidine-1-carbonyl)-4-oxatricyclo[4.2.1.03,7]nonan-5-one.
| Compound Name | (1R,3R,6R,7R,9S)-9-(2,6-dimethylpiperidine-1-carbonyl)-4-oxatricyclo[4.2.1.03,7]nonan-5-one |
|---|---|
| PubChem CID | 53013452 |
| Molecular Formula | C16H23NO3 |
| Molecular Weight | 277.36 g/mol |
| Exact Mass | 277.17 |
| IUPAC Name | (1R,3R,6R,7R,9S)-9-(2,6-dimethylpiperidine-1-carbonyl)-4-oxatricyclo[4.2.1.03,7]nonan-5-one |
| SMILES | CC1CCCC(C)N1C(=O)[C@H]1[C@@H]2C[C@@H]3[C@H]1C(=O)O[C@@H]3C2 |
| InChI | InChI=1S/C16H23NO3/c1-8-4-3-5-9(2)17(8)15(18)13-10-6-11-12(7-10)20-16(19)14(11)13/h8-14H,3-7H2,1-2H3/t8?,9?,10-,11+,12-,13+,14-/m1/s1 |
| InChIKey | VHQBTPGGDSXDSX-BQAJRTCMSA-N |
| XLogP | 1.97 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.36 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |