C19H11FO4 — CID 5301369
4-(3-fluorophenyl)-3,4-dihydrobenzo[g]chromene-2,5,10-trione (PubChem CID 5301369) has the molecular formula C19H11FO4 and a molecular weight of 322.29 g/mol. Its IUPAC name is 4-(3-fluorophenyl)-3,4-dihydrobenzo[g]chromene-2,5,10-trione.
| Compound Name | 4-(3-fluorophenyl)-3,4-dihydrobenzo[g]chromene-2,5,10-trione |
|---|---|
| PubChem CID | 5301369 |
| Molecular Formula | C19H11FO4 |
| Molecular Weight | 322.29 g/mol |
| Exact Mass | 322.06 |
| IUPAC Name | 4-(3-fluorophenyl)-3,4-dihydrobenzo[g]chromene-2,5,10-trione |
| SMILES | O=C1CC(c2cccc(F)c2)C2=C(O1)C(=O)c1ccccc1C2=O |
| InChI | InChI=1S/C19H11FO4/c20-11-5-3-4-10(8-11)14-9-15(21)24-19-16(14)17(22)12-6-1-2-7-13(12)18(19)23/h1-8,14H,9H2 |
| InChIKey | DQMVOFRGANVPQM-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.29 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|