C18H19NO2 — CID 53013816
3-[(3aS,9bS)-8-methyl-2,3,3a,4,5,9b-hexahydrofuro[3,2-c]quinolin-4-yl]phenol (PubChem CID 53013816) has the molecular formula C18H19NO2 and a molecular weight of 281.36 g/mol. Its IUPAC name is 3-[(3aS,9bS)-8-methyl-2,3,3a,4,5,9b-hexahydrofuro[3,2-c]quinolin-4-yl]phenol.
| Compound Name | 3-[(3aS,9bS)-8-methyl-2,3,3a,4,5,9b-hexahydrofuro[3,2-c]quinolin-4-yl]phenol |
|---|---|
| PubChem CID | 53013816 |
| Molecular Formula | C18H19NO2 |
| Molecular Weight | 281.36 g/mol |
| Exact Mass | 281.14 |
| IUPAC Name | 3-[(3aS,9bS)-8-methyl-2,3,3a,4,5,9b-hexahydrofuro[3,2-c]quinolin-4-yl]phenol |
| SMILES | Cc1ccc2c(c1)[C@H]1OCC[C@H]1C(c1cccc(O)c1)N2 |
| InChI | InChI=1S/C18H19NO2/c1-11-5-6-16-15(9-11)18-14(7-8-21-18)17(19-16)12-3-2-4-13(20)10-12/h2-6,9-10,14,17-20H,7-8H2,1H3/t14-,17?,18-/m0/s1 |
| InChIKey | VPDJYODYIQKSAM-HRWMIKOJSA-N |
| XLogP | 3.95 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.36 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |