About N,4-dimethyl-2-pyrrol-1-yl-1,3-thiazole-5-carboxamide
N,4-dimethyl-2-pyrrol-1-yl-1,3-thiazole-5-carboxamide (PubChem CID 53013907) has the molecular formula C10H11N3OS
and a molecular weight of 221.28 g/mol. Its IUPAC name is N,4-dimethyl-2-pyrrol-1-yl-1,3-thiazole-5-carboxamide.
Molecular Properties
| Compound Name | N,4-dimethyl-2-pyrrol-1-yl-1,3-thiazole-5-carboxamide |
| PubChem CID | 53013907 |
| Molecular Formula | C10H11N3OS |
| Molecular Weight | 221.28 g/mol |
| Exact Mass | 221.06 |
| IUPAC Name | N,4-dimethyl-2-pyrrol-1-yl-1,3-thiazole-5-carboxamide |
| SMILES | CNC(=O)c1sc(-n2cccc2)nc1C |
| InChI | InChI=1S/C10H11N3OS/c1-7-8(9(14)11-2)15-10(12-7)13-5-3-4-6-13/h3-6H,1-2H3,(H,11,14) |
| InChIKey | GAUYGNSPFMVTIM-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 221.28 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N,4-dimethyl-2-pyrrol-1-yl-1,3-thiazole-5-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N,4-dimethyl-2-pyrrol-1-yl-1,3-thiazole-5-carboxamide?
The IUPAC name of N,4-dimethyl-2-pyrrol-1-yl-1,3-thiazole-5-carboxamide (CID 53013907) is N,4-dimethyl-2-pyrrol-1-yl-1,3-thiazole-5-carboxamide.
What is the SMILES notation for N,4-dimethyl-2-pyrrol-1-yl-1,3-thiazole-5-carboxamide?
The canonical SMILES for N,4-dimethyl-2-pyrrol-1-yl-1,3-thiazole-5-carboxamide is CNC(=O)c1sc(-n2cccc2)nc1C.
What is the InChIKey of N,4-dimethyl-2-pyrrol-1-yl-1,3-thiazole-5-carboxamide?
The InChIKey is GAUYGNSPFMVTIM-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H11N3OS/c1-7-8(9(14)11-2)15-10(12-7)13-5-3-4-6-13/h3-6H,1-2H3,(H,11,14).
What are the key properties of N,4-dimethyl-2-pyrrol-1-yl-1,3-thiazole-5-carboxamide?
N,4-dimethyl-2-pyrrol-1-yl-1,3-thiazole-5-carboxamide has a molecular weight of 221.28 g/mol, XLogP of 1.60, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N,4-dimethyl-2-pyrrol-1-yl-1,3-thiazole-5-carboxamide is sourced from PubChem (CID 53013907), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).