C15H15N5O — CID 53014321
1-benzyl-3-(3-methyl-[1,2,4]triazolo[4,3-a]pyridin-6-yl)urea (PubChem CID 53014321) has the molecular formula C15H15N5O and a molecular weight of 281.32 g/mol. Its IUPAC name is 1-benzyl-3-(3-methyl-[1,2,4]triazolo[4,3-a]pyridin-6-yl)urea.
| Compound Name | 1-benzyl-3-(3-methyl-[1,2,4]triazolo[4,3-a]pyridin-6-yl)urea |
|---|---|
| PubChem CID | 53014321 |
| Molecular Formula | C15H15N5O |
| Molecular Weight | 281.32 g/mol |
| Exact Mass | 281.13 |
| IUPAC Name | 1-benzyl-3-(3-methyl-[1,2,4]triazolo[4,3-a]pyridin-6-yl)urea |
| SMILES | Cc1nnc2ccc(NC(=O)NCc3ccccc3)cn12 |
| InChI | InChI=1S/C15H15N5O/c1-11-18-19-14-8-7-13(10-20(11)14)17-15(21)16-9-12-5-3-2-4-6-12/h2-8,10H,9H2,1H3,(H2,16,17,21) |
| InChIKey | QMPBQCJGBHFSES-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 71.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.32 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |