C12H11N7O3S — CID 5301450
5-[[5-(2-methoxyphenyl)-1H-1,2,4-triazol-3-yl]sulfanyl]-1-methyl-3-nitro-1,2,4-triazole (PubChem CID 5301450) has the molecular formula C12H11N7O3S and a molecular weight of 333.33 g/mol. Its IUPAC name is 5-[[5-(2-methoxyphenyl)-1H-1,2,4-triazol-3-yl]sulfanyl]-1-methyl-3-nitro-1,2,4-triazole.
| Compound Name | 5-[[5-(2-methoxyphenyl)-1H-1,2,4-triazol-3-yl]sulfanyl]-1-methyl-3-nitro-1,2,4-triazole |
|---|---|
| PubChem CID | 5301450 |
| Molecular Formula | C12H11N7O3S |
| Molecular Weight | 333.33 g/mol |
| Exact Mass | 333.06 |
| IUPAC Name | 5-[[5-(2-methoxyphenyl)-1H-1,2,4-triazol-3-yl]sulfanyl]-1-methyl-3-nitro-1,2,4-triazole |
| SMILES | COc1ccccc1-c1nc(Sc2nc([N+](=O)[O-])nn2C)n[nH]1 |
| InChI | InChI=1S/C12H11N7O3S/c1-18-12(14-10(17-18)19(20)21)23-11-13-9(15-16-11)7-5-3-4-6-8(7)22-2/h3-6H,1-2H3,(H,13,15,16) |
| InChIKey | PFSJYHOLAOSGPV-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 124.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.33 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|