C14H11ClN4O — CID 53014558
N-[(2-chlorophenyl)methyl]imidazo[1,2-a]pyrazine-2-carboxamide (PubChem CID 53014558) has the molecular formula C14H11ClN4O and a molecular weight of 286.72 g/mol. Its IUPAC name is N-[(2-chlorophenyl)methyl]imidazo[1,2-a]pyrazine-2-carboxamide.
| Compound Name | N-[(2-chlorophenyl)methyl]imidazo[1,2-a]pyrazine-2-carboxamide |
|---|---|
| PubChem CID | 53014558 |
| Molecular Formula | C14H11ClN4O |
| Molecular Weight | 286.72 g/mol |
| Exact Mass | 286.06 |
| IUPAC Name | N-[(2-chlorophenyl)methyl]imidazo[1,2-a]pyrazine-2-carboxamide |
| SMILES | O=C(NCc1ccccc1Cl)c1cn2ccncc2n1 |
| InChI | InChI=1S/C14H11ClN4O/c15-11-4-2-1-3-10(11)7-17-14(20)12-9-19-6-5-16-8-13(19)18-12/h1-6,8-9H,7H2,(H,17,20) |
| InChIKey | QOARGRWIRRVGQT-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 59.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.72 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |