About N,N-dimethyl-2-(4-methylpiperazin-1-yl)-1,3-thiazole-4-carboxamide
N,N-dimethyl-2-(4-methylpiperazin-1-yl)-1,3-thiazole-4-carboxamide (PubChem CID 53014663) has the molecular formula C11H18N4OS
and a molecular weight of 254.36 g/mol. Its IUPAC name is N,N-dimethyl-2-(4-methylpiperazin-1-yl)-1,3-thiazole-4-carboxamide.
Molecular Properties
| Compound Name | N,N-dimethyl-2-(4-methylpiperazin-1-yl)-1,3-thiazole-4-carboxamide |
| PubChem CID | 53014663 |
| Molecular Formula | C11H18N4OS |
| Molecular Weight | 254.36 g/mol |
| Exact Mass | 254.12 |
| IUPAC Name | N,N-dimethyl-2-(4-methylpiperazin-1-yl)-1,3-thiazole-4-carboxamide |
| SMILES | CN1CCN(c2nc(C(=O)N(C)C)cs2)CC1 |
| InChI | InChI=1S/C11H18N4OS/c1-13(2)10(16)9-8-17-11(12-9)15-6-4-14(3)5-7-15/h8H,4-7H2,1-3H3 |
| InChIKey | DYAJWNFCQIAQTL-UHFFFAOYSA-N |
| XLogP | 0.60 |
| TPSA | 39.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 254.36 |
| LogP ≤ 5 | 0.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze N,N-dimethyl-2-(4-methylpiperazin-1-yl)-1,3-thiazole-4-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N,N-dimethyl-2-(4-methylpiperazin-1-yl)-1,3-thiazole-4-carboxamide?
The IUPAC name of N,N-dimethyl-2-(4-methylpiperazin-1-yl)-1,3-thiazole-4-carboxamide (CID 53014663) is N,N-dimethyl-2-(4-methylpiperazin-1-yl)-1,3-thiazole-4-carboxamide.
What is the SMILES notation for N,N-dimethyl-2-(4-methylpiperazin-1-yl)-1,3-thiazole-4-carboxamide?
The canonical SMILES for N,N-dimethyl-2-(4-methylpiperazin-1-yl)-1,3-thiazole-4-carboxamide is CN1CCN(c2nc(C(=O)N(C)C)cs2)CC1.
What is the InChIKey of N,N-dimethyl-2-(4-methylpiperazin-1-yl)-1,3-thiazole-4-carboxamide?
The InChIKey is DYAJWNFCQIAQTL-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H18N4OS/c1-13(2)10(16)9-8-17-11(12-9)15-6-4-14(3)5-7-15/h8H,4-7H2,1-3H3.
What are the key properties of N,N-dimethyl-2-(4-methylpiperazin-1-yl)-1,3-thiazole-4-carboxamide?
N,N-dimethyl-2-(4-methylpiperazin-1-yl)-1,3-thiazole-4-carboxamide has a molecular weight of 254.36 g/mol, XLogP of 0.60, 2 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N,N-dimethyl-2-(4-methylpiperazin-1-yl)-1,3-thiazole-4-carboxamide is sourced from PubChem (CID 53014663), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).