About [3-(3-fluorophenyl)-1,2-thiazol-5-yl]-pyrrolidin-1-ylmethanone
[3-(3-fluorophenyl)-1,2-thiazol-5-yl]-pyrrolidin-1-ylmethanone (PubChem CID 53014946) has the molecular formula C14H13FN2OS
and a molecular weight of 276.34 g/mol. Its IUPAC name is [3-(3-fluorophenyl)-1,2-thiazol-5-yl]-pyrrolidin-1-ylmethanone.
Molecular Properties
| Compound Name | [3-(3-fluorophenyl)-1,2-thiazol-5-yl]-pyrrolidin-1-ylmethanone |
| PubChem CID | 53014946 |
| Molecular Formula | C14H13FN2OS |
| Molecular Weight | 276.34 g/mol |
| Exact Mass | 276.07 |
| IUPAC Name | [3-(3-fluorophenyl)-1,2-thiazol-5-yl]-pyrrolidin-1-ylmethanone |
| SMILES | O=C(c1cc(-c2cccc(F)c2)ns1)N1CCCC1 |
| InChI | InChI=1S/C14H13FN2OS/c15-11-5-3-4-10(8-11)12-9-13(19-16-12)14(18)17-6-1-2-7-17/h3-5,8-9H,1-2,6-7H2 |
| InChIKey | ABTZVEXEVCVJLF-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 33.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 276.34 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze [3-(3-fluorophenyl)-1,2-thiazol-5-yl]-pyrrolidin-1-ylmethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [3-(3-fluorophenyl)-1,2-thiazol-5-yl]-pyrrolidin-1-ylmethanone?
The IUPAC name of [3-(3-fluorophenyl)-1,2-thiazol-5-yl]-pyrrolidin-1-ylmethanone (CID 53014946) is [3-(3-fluorophenyl)-1,2-thiazol-5-yl]-pyrrolidin-1-ylmethanone.
What is the SMILES notation for [3-(3-fluorophenyl)-1,2-thiazol-5-yl]-pyrrolidin-1-ylmethanone?
The canonical SMILES for [3-(3-fluorophenyl)-1,2-thiazol-5-yl]-pyrrolidin-1-ylmethanone is O=C(c1cc(-c2cccc(F)c2)ns1)N1CCCC1.
What is the InChIKey of [3-(3-fluorophenyl)-1,2-thiazol-5-yl]-pyrrolidin-1-ylmethanone?
The InChIKey is ABTZVEXEVCVJLF-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H13FN2OS/c15-11-5-3-4-10(8-11)12-9-13(19-16-12)14(18)17-6-1-2-7-17/h3-5,8-9H,1-2,6-7H2.
What are the key properties of [3-(3-fluorophenyl)-1,2-thiazol-5-yl]-pyrrolidin-1-ylmethanone?
[3-(3-fluorophenyl)-1,2-thiazol-5-yl]-pyrrolidin-1-ylmethanone has a molecular weight of 276.34 g/mol, XLogP of 3.19, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [3-(3-fluorophenyl)-1,2-thiazol-5-yl]-pyrrolidin-1-ylmethanone is sourced from PubChem (CID 53014946), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).