C18H20N2O2 — CID 53015005
[4-(2,3-dihydroindol-1-yl)piperidin-1-yl]-(furan-3-yl)methanone (PubChem CID 53015005) has the molecular formula C18H20N2O2 and a molecular weight of 296.37 g/mol. Its IUPAC name is [4-(2,3-dihydroindol-1-yl)piperidin-1-yl]-(furan-3-yl)methanone.
| Compound Name | [4-(2,3-dihydroindol-1-yl)piperidin-1-yl]-(furan-3-yl)methanone |
|---|---|
| PubChem CID | 53015005 |
| Molecular Formula | C18H20N2O2 |
| Molecular Weight | 296.37 g/mol |
| Exact Mass | 296.15 |
| IUPAC Name | [4-(2,3-dihydroindol-1-yl)piperidin-1-yl]-(furan-3-yl)methanone |
| SMILES | O=C(c1ccoc1)N1CCC(N2CCc3ccccc32)CC1 |
| InChI | InChI=1S/C18H20N2O2/c21-18(15-8-12-22-13-15)19-9-6-16(7-10-19)20-11-5-14-3-1-2-4-17(14)20/h1-4,8,12-13,16H,5-7,9-11H2 |
| InChIKey | FBZACRRYEIDZCN-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 36.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.37 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |