About 8-methyloctadecane
8-methyloctadecane (PubChem CID 530154) has the molecular formula C19H40
and a molecular weight of 268.53 g/mol. Its IUPAC name is 8-methyloctadecane.
Molecular Properties
| Compound Name | 8-methyloctadecane |
| PubChem CID | 530154 |
| Molecular Formula | C19H40 |
| Molecular Weight | 268.53 g/mol |
| Exact Mass | 268.31 |
| IUPAC Name | 8-methyloctadecane |
| SMILES | CCCCCCCCCCC(C)CCCCCCC |
| InChI | InChI=1S/C19H40/c1-4-6-8-10-11-12-14-16-18-19(3)17-15-13-9-7-5-2/h19H,4-18H2,1-3H3 |
| InChIKey | KXHLRGBHQWFLAZ-UHFFFAOYSA-N |
| XLogP | 7.51 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 15 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 268.53 |
| LogP ≤ 5 | 7.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 8-methyloctadecane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-methyloctadecane?
The IUPAC name of 8-methyloctadecane (CID 530154) is 8-methyloctadecane.
What is the SMILES notation for 8-methyloctadecane?
The canonical SMILES for 8-methyloctadecane is CCCCCCCCCCC(C)CCCCCCC.
What is the InChIKey of 8-methyloctadecane?
The InChIKey is KXHLRGBHQWFLAZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H40/c1-4-6-8-10-11-12-14-16-18-19(3)17-15-13-9-7-5-2/h19H,4-18H2,1-3H3.
What are the key properties of 8-methyloctadecane?
8-methyloctadecane has a molecular weight of 268.53 g/mol, XLogP of 7.51, 15 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 8-methyloctadecane is sourced from PubChem (CID 530154), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).