About N-(2-cyanoethyl)-N,4-dimethylthieno[3,2-b]pyrrole-5-carboxamide
N-(2-cyanoethyl)-N,4-dimethylthieno[3,2-b]pyrrole-5-carboxamide (PubChem CID 53015597) has the molecular formula C12H13N3OS
and a molecular weight of 247.32 g/mol. Its IUPAC name is N-(2-cyanoethyl)-N,4-dimethylthieno[3,2-b]pyrrole-5-carboxamide.
Molecular Properties
| Compound Name | N-(2-cyanoethyl)-N,4-dimethylthieno[3,2-b]pyrrole-5-carboxamide |
| PubChem CID | 53015597 |
| Molecular Formula | C12H13N3OS |
| Molecular Weight | 247.32 g/mol |
| Exact Mass | 247.08 |
| IUPAC Name | N-(2-cyanoethyl)-N,4-dimethylthieno[3,2-b]pyrrole-5-carboxamide |
| SMILES | CN(CCC#N)C(=O)c1cc2sccc2n1C |
| InChI | InChI=1S/C12H13N3OS/c1-14(6-3-5-13)12(16)10-8-11-9(15(10)2)4-7-17-11/h4,7-8H,3,6H2,1-2H3 |
| InChIKey | ZLIJNZWHHYOVBS-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 49.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 247.32 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N-(2-cyanoethyl)-N,4-dimethylthieno[3,2-b]pyrrole-5-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(2-cyanoethyl)-N,4-dimethylthieno[3,2-b]pyrrole-5-carboxamide?
The IUPAC name of N-(2-cyanoethyl)-N,4-dimethylthieno[3,2-b]pyrrole-5-carboxamide (CID 53015597) is N-(2-cyanoethyl)-N,4-dimethylthieno[3,2-b]pyrrole-5-carboxamide.
What is the SMILES notation for N-(2-cyanoethyl)-N,4-dimethylthieno[3,2-b]pyrrole-5-carboxamide?
The canonical SMILES for N-(2-cyanoethyl)-N,4-dimethylthieno[3,2-b]pyrrole-5-carboxamide is CN(CCC#N)C(=O)c1cc2sccc2n1C.
What is the InChIKey of N-(2-cyanoethyl)-N,4-dimethylthieno[3,2-b]pyrrole-5-carboxamide?
The InChIKey is ZLIJNZWHHYOVBS-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H13N3OS/c1-14(6-3-5-13)12(16)10-8-11-9(15(10)2)4-7-17-11/h4,7-8H,3,6H2,1-2H3.
What are the key properties of N-(2-cyanoethyl)-N,4-dimethylthieno[3,2-b]pyrrole-5-carboxamide?
N-(2-cyanoethyl)-N,4-dimethylthieno[3,2-b]pyrrole-5-carboxamide has a molecular weight of 247.32 g/mol, XLogP of 2.23, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-(2-cyanoethyl)-N,4-dimethylthieno[3,2-b]pyrrole-5-carboxamide is sourced from PubChem (CID 53015597), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).