C16H17N3O — CID 53015626
N-(cyanomethyl)-N,2,6,8-tetramethylquinoline-4-carboxamide (PubChem CID 53015626) has the molecular formula C16H17N3O and a molecular weight of 267.33 g/mol. Its IUPAC name is N-(cyanomethyl)-N,2,6,8-tetramethylquinoline-4-carboxamide.
| Compound Name | N-(cyanomethyl)-N,2,6,8-tetramethylquinoline-4-carboxamide |
|---|---|
| PubChem CID | 53015626 |
| Molecular Formula | C16H17N3O |
| Molecular Weight | 267.33 g/mol |
| Exact Mass | 267.14 |
| IUPAC Name | N-(cyanomethyl)-N,2,6,8-tetramethylquinoline-4-carboxamide |
| SMILES | Cc1cc(C)c2nc(C)cc(C(=O)N(C)CC#N)c2c1 |
| InChI | InChI=1S/C16H17N3O/c1-10-7-11(2)15-13(8-10)14(9-12(3)18-15)16(20)19(4)6-5-17/h7-9H,6H2,1-4H3 |
| InChIKey | SROUJPWUSXEIJR-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 56.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.33 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'cyanamide', 'substructure': 'N/A'} |
|---|