C14H20N4O — CID 53015702
N-(cyanomethyl)-2-(4,5,6,7,8,9-hexahydrocycloocta[c]pyrazol-2-yl)-N-methylacetamide (PubChem CID 53015702) has the molecular formula C14H20N4O and a molecular weight of 260.34 g/mol. Its IUPAC name is N-(cyanomethyl)-2-(4,5,6,7,8,9-hexahydrocycloocta[c]pyrazol-2-yl)-N-methylacetamide.
| Compound Name | N-(cyanomethyl)-2-(4,5,6,7,8,9-hexahydrocycloocta[c]pyrazol-2-yl)-N-methylacetamide |
|---|---|
| PubChem CID | 53015702 |
| Molecular Formula | C14H20N4O |
| Molecular Weight | 260.34 g/mol |
| Exact Mass | 260.16 |
| IUPAC Name | N-(cyanomethyl)-2-(4,5,6,7,8,9-hexahydrocycloocta[c]pyrazol-2-yl)-N-methylacetamide |
| SMILES | CN(CC#N)C(=O)Cn1cc2c(n1)CCCCCC2 |
| InChI | InChI=1S/C14H20N4O/c1-17(9-8-15)14(19)11-18-10-12-6-4-2-3-5-7-13(12)16-18/h10H,2-7,9,11H2,1H3 |
| InChIKey | ROLKKIUPRKSNMF-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 61.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.34 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cyanamide', 'substructure': 'N/A'} |
|---|