C17H22N4O — CID 53015709
pyrrolidin-1-yl(2,3,7-triazatricyclo[7.6.0.02,6]pentadeca-1(9),3,5,7-tetraen-5-yl)methanone (PubChem CID 53015709) has the molecular formula C17H22N4O and a molecular weight of 298.39 g/mol. Its IUPAC name is pyrrolidin-1-yl(2,3,7-triazatricyclo[7.6.0.02,6]pentadeca-1(9),3,5,7-tetraen-5-yl)methanone.
| Compound Name | pyrrolidin-1-yl(2,3,7-triazatricyclo[7.6.0.02,6]pentadeca-1(9),3,5,7-tetraen-5-yl)methanone |
|---|---|
| PubChem CID | 53015709 |
| Molecular Formula | C17H22N4O |
| Molecular Weight | 298.39 g/mol |
| Exact Mass | 298.18 |
| IUPAC Name | pyrrolidin-1-yl(2,3,7-triazatricyclo[7.6.0.02,6]pentadeca-1(9),3,5,7-tetraen-5-yl)methanone |
| SMILES | O=C(c1cnn2c3c(cnc12)CCCCCC3)N1CCCC1 |
| InChI | InChI=1S/C17H22N4O/c22-17(20-9-5-6-10-20)14-12-19-21-15-8-4-2-1-3-7-13(15)11-18-16(14)21/h11-12H,1-10H2 |
| InChIKey | XXIAEIYKUAZZQC-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 50.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.39 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |