C17H22N4O — CID 53015717
N-methyl-N-prop-2-enyl-2,3,7-triazatricyclo[7.6.0.02,6]pentadeca-1(9),3,5,7-tetraene-5-carboxamide (PubChem CID 53015717) has the molecular formula C17H22N4O and a molecular weight of 298.39 g/mol. Its IUPAC name is N-methyl-N-prop-2-enyl-2,3,7-triazatricyclo[7.6.0.02,6]pentadeca-1(9),3,5,7-tetraene-5-carboxamide.
| Compound Name | N-methyl-N-prop-2-enyl-2,3,7-triazatricyclo[7.6.0.02,6]pentadeca-1(9),3,5,7-tetraene-5-carboxamide |
|---|---|
| PubChem CID | 53015717 |
| Molecular Formula | C17H22N4O |
| Molecular Weight | 298.39 g/mol |
| Exact Mass | 298.18 |
| IUPAC Name | N-methyl-N-prop-2-enyl-2,3,7-triazatricyclo[7.6.0.02,6]pentadeca-1(9),3,5,7-tetraene-5-carboxamide |
| SMILES | C=CCN(C)C(=O)c1cnn2c3c(cnc12)CCCCCC3 |
| InChI | InChI=1S/C17H22N4O/c1-3-10-20(2)17(22)14-12-19-21-15-9-7-5-4-6-8-13(15)11-18-16(14)21/h3,11-12H,1,4-10H2,2H3 |
| InChIKey | MHGRIXKPDLVBFS-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 50.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.39 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|