About N-(cyanomethyl)-N,1-dimethyl-4H-chromeno[3,4-d]pyrazole-3-carboxamide
N-(cyanomethyl)-N,1-dimethyl-4H-chromeno[3,4-d]pyrazole-3-carboxamide (PubChem CID 53015763) has the molecular formula C15H14N4O2
and a molecular weight of 282.30 g/mol. Its IUPAC name is N-(cyanomethyl)-N,1-dimethyl-4H-chromeno[3,4-d]pyrazole-3-carboxamide.
Molecular Properties
| Compound Name | N-(cyanomethyl)-N,1-dimethyl-4H-chromeno[3,4-d]pyrazole-3-carboxamide |
| PubChem CID | 53015763 |
| Molecular Formula | C15H14N4O2 |
| Molecular Weight | 282.30 g/mol |
| Exact Mass | 282.11 |
| IUPAC Name | N-(cyanomethyl)-N,1-dimethyl-4H-chromeno[3,4-d]pyrazole-3-carboxamide |
| SMILES | CN(CC#N)C(=O)c1nn(C)c2c1COc1ccccc1-2 |
| InChI | InChI=1S/C15H14N4O2/c1-18(8-7-16)15(20)13-11-9-21-12-6-4-3-5-10(12)14(11)19(2)17-13/h3-6H,8-9H2,1-2H3 |
| InChIKey | ZNMMBHGDWUZLNM-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 71.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 282.30 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'cyanamide', 'substructure': 'N/A'} |
|---|
Analyze N-(cyanomethyl)-N,1-dimethyl-4H-chromeno[3,4-d]pyrazole-3-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(cyanomethyl)-N,1-dimethyl-4H-chromeno[3,4-d]pyrazole-3-carboxamide?
The IUPAC name of N-(cyanomethyl)-N,1-dimethyl-4H-chromeno[3,4-d]pyrazole-3-carboxamide (CID 53015763) is N-(cyanomethyl)-N,1-dimethyl-4H-chromeno[3,4-d]pyrazole-3-carboxamide.
What is the SMILES notation for N-(cyanomethyl)-N,1-dimethyl-4H-chromeno[3,4-d]pyrazole-3-carboxamide?
The canonical SMILES for N-(cyanomethyl)-N,1-dimethyl-4H-chromeno[3,4-d]pyrazole-3-carboxamide is CN(CC#N)C(=O)c1nn(C)c2c1COc1ccccc1-2.
What is the InChIKey of N-(cyanomethyl)-N,1-dimethyl-4H-chromeno[3,4-d]pyrazole-3-carboxamide?
The InChIKey is ZNMMBHGDWUZLNM-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H14N4O2/c1-18(8-7-16)15(20)13-11-9-21-12-6-4-3-5-10(12)14(11)19(2)17-13/h3-6H,8-9H2,1-2H3.
What are the key properties of N-(cyanomethyl)-N,1-dimethyl-4H-chromeno[3,4-d]pyrazole-3-carboxamide?
N-(cyanomethyl)-N,1-dimethyl-4H-chromeno[3,4-d]pyrazole-3-carboxamide has a molecular weight of 282.30 g/mol, XLogP of 1.58, 2 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-(cyanomethyl)-N,1-dimethyl-4H-chromeno[3,4-d]pyrazole-3-carboxamide is sourced from PubChem (CID 53015763), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).