About 1-(4-ethylsulfonyl-1,4-diazepan-1-yl)-2,2-dimethylpropan-1-one
1-(4-ethylsulfonyl-1,4-diazepan-1-yl)-2,2-dimethylpropan-1-one (PubChem CID 53016369) has the molecular formula C12H24N2O3S
and a molecular weight of 276.40 g/mol. Its IUPAC name is 1-(4-ethylsulfonyl-1,4-diazepan-1-yl)-2,2-dimethylpropan-1-one.
Molecular Properties
| Compound Name | 1-(4-ethylsulfonyl-1,4-diazepan-1-yl)-2,2-dimethylpropan-1-one |
| PubChem CID | 53016369 |
| Molecular Formula | C12H24N2O3S |
| Molecular Weight | 276.40 g/mol |
| Exact Mass | 276.15 |
| IUPAC Name | 1-(4-ethylsulfonyl-1,4-diazepan-1-yl)-2,2-dimethylpropan-1-one |
| SMILES | CCS(=O)(=O)N1CCCN(C(=O)C(C)(C)C)CC1 |
| InChI | InChI=1S/C12H24N2O3S/c1-5-18(16,17)14-8-6-7-13(9-10-14)11(15)12(2,3)4/h5-10H2,1-4H3 |
| InChIKey | ITTFXSBVAQQVTG-UHFFFAOYSA-N |
| XLogP | 0.92 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 276.40 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-(4-ethylsulfonyl-1,4-diazepan-1-yl)-2,2-dimethylpropan-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(4-ethylsulfonyl-1,4-diazepan-1-yl)-2,2-dimethylpropan-1-one?
The IUPAC name of 1-(4-ethylsulfonyl-1,4-diazepan-1-yl)-2,2-dimethylpropan-1-one (CID 53016369) is 1-(4-ethylsulfonyl-1,4-diazepan-1-yl)-2,2-dimethylpropan-1-one.
What is the SMILES notation for 1-(4-ethylsulfonyl-1,4-diazepan-1-yl)-2,2-dimethylpropan-1-one?
The canonical SMILES for 1-(4-ethylsulfonyl-1,4-diazepan-1-yl)-2,2-dimethylpropan-1-one is CCS(=O)(=O)N1CCCN(C(=O)C(C)(C)C)CC1.
What is the InChIKey of 1-(4-ethylsulfonyl-1,4-diazepan-1-yl)-2,2-dimethylpropan-1-one?
The InChIKey is ITTFXSBVAQQVTG-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H24N2O3S/c1-5-18(16,17)14-8-6-7-13(9-10-14)11(15)12(2,3)4/h5-10H2,1-4H3.
What are the key properties of 1-(4-ethylsulfonyl-1,4-diazepan-1-yl)-2,2-dimethylpropan-1-one?
1-(4-ethylsulfonyl-1,4-diazepan-1-yl)-2,2-dimethylpropan-1-one has a molecular weight of 276.40 g/mol, XLogP of 0.92, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(4-ethylsulfonyl-1,4-diazepan-1-yl)-2,2-dimethylpropan-1-one is sourced from PubChem (CID 53016369), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).