About 1-[3-(4-ethyl-1,3-thiazol-2-yl)piperidin-1-yl]-2,2-dimethylpropan-1-one
1-[3-(4-ethyl-1,3-thiazol-2-yl)piperidin-1-yl]-2,2-dimethylpropan-1-one (PubChem CID 53016855) has the molecular formula C15H24N2OS
and a molecular weight of 280.44 g/mol. Its IUPAC name is 1-[3-(4-ethyl-1,3-thiazol-2-yl)piperidin-1-yl]-2,2-dimethylpropan-1-one.
Molecular Properties
| Compound Name | 1-[3-(4-ethyl-1,3-thiazol-2-yl)piperidin-1-yl]-2,2-dimethylpropan-1-one |
| PubChem CID | 53016855 |
| Molecular Formula | C15H24N2OS |
| Molecular Weight | 280.44 g/mol |
| Exact Mass | 280.16 |
| IUPAC Name | 1-[3-(4-ethyl-1,3-thiazol-2-yl)piperidin-1-yl]-2,2-dimethylpropan-1-one |
| SMILES | CCc1csc(C2CCCN(C(=O)C(C)(C)C)C2)n1 |
| InChI | InChI=1S/C15H24N2OS/c1-5-12-10-19-13(16-12)11-7-6-8-17(9-11)14(18)15(2,3)4/h10-11H,5-9H2,1-4H3 |
| InChIKey | CKEBCUSKFCOVRE-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 33.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 280.44 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-[3-(4-ethyl-1,3-thiazol-2-yl)piperidin-1-yl]-2,2-dimethylpropan-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[3-(4-ethyl-1,3-thiazol-2-yl)piperidin-1-yl]-2,2-dimethylpropan-1-one?
The IUPAC name of 1-[3-(4-ethyl-1,3-thiazol-2-yl)piperidin-1-yl]-2,2-dimethylpropan-1-one (CID 53016855) is 1-[3-(4-ethyl-1,3-thiazol-2-yl)piperidin-1-yl]-2,2-dimethylpropan-1-one.
What is the SMILES notation for 1-[3-(4-ethyl-1,3-thiazol-2-yl)piperidin-1-yl]-2,2-dimethylpropan-1-one?
The canonical SMILES for 1-[3-(4-ethyl-1,3-thiazol-2-yl)piperidin-1-yl]-2,2-dimethylpropan-1-one is CCc1csc(C2CCCN(C(=O)C(C)(C)C)C2)n1.
What is the InChIKey of 1-[3-(4-ethyl-1,3-thiazol-2-yl)piperidin-1-yl]-2,2-dimethylpropan-1-one?
The InChIKey is CKEBCUSKFCOVRE-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H24N2OS/c1-5-12-10-19-13(16-12)11-7-6-8-17(9-11)14(18)15(2,3)4/h10-11H,5-9H2,1-4H3.
What are the key properties of 1-[3-(4-ethyl-1,3-thiazol-2-yl)piperidin-1-yl]-2,2-dimethylpropan-1-one?
1-[3-(4-ethyl-1,3-thiazol-2-yl)piperidin-1-yl]-2,2-dimethylpropan-1-one has a molecular weight of 280.44 g/mol, XLogP of 3.46, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[3-(4-ethyl-1,3-thiazol-2-yl)piperidin-1-yl]-2,2-dimethylpropan-1-one is sourced from PubChem (CID 53016855), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).