C11H16N2O — CID 53017343
5-cyclopropyl-3-(pyrrolidin-1-ylmethyl)-1,2-oxazole (PubChem CID 53017343) has the molecular formula C11H16N2O and a molecular weight of 192.26 g/mol. Its IUPAC name is 5-cyclopropyl-3-(pyrrolidin-1-ylmethyl)-1,2-oxazole.
| Compound Name | 5-cyclopropyl-3-(pyrrolidin-1-ylmethyl)-1,2-oxazole |
|---|---|
| PubChem CID | 53017343 |
| Molecular Formula | C11H16N2O |
| Molecular Weight | 192.26 g/mol |
| Exact Mass | 192.13 |
| IUPAC Name | 5-cyclopropyl-3-(pyrrolidin-1-ylmethyl)-1,2-oxazole |
| SMILES | c1c(CN2CCCC2)noc1C1CC1 |
| InChI | InChI=1S/C11H16N2O/c1-2-6-13(5-1)8-10-7-11(14-12-10)9-3-4-9/h7,9H,1-6,8H2 |
| InChIKey | JJEJXUBQZFBQME-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 29.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.26 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |