C9H13N5 — CID 53017570
N-butyl-[1,2,4]triazolo[4,3-b]pyridazin-6-amine (PubChem CID 53017570) has the molecular formula C9H13N5 and a molecular weight of 191.24 g/mol. Its IUPAC name is N-butyl-[1,2,4]triazolo[4,3-b]pyridazin-6-amine.
| Compound Name | N-butyl-[1,2,4]triazolo[4,3-b]pyridazin-6-amine |
|---|---|
| PubChem CID | 53017570 |
| Molecular Formula | C9H13N5 |
| Molecular Weight | 191.24 g/mol |
| Exact Mass | 191.12 |
| IUPAC Name | N-butyl-[1,2,4]triazolo[4,3-b]pyridazin-6-amine |
| SMILES | CCCCNc1ccc2nncn2n1 |
| InChI | InChI=1S/C9H13N5/c1-2-3-6-10-8-4-5-9-12-11-7-14(9)13-8/h4-5,7H,2-3,6H2,1H3,(H,10,13) |
| InChIKey | QYSTXZTXOAPQQM-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 55.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 191.24 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|