C23H18ClNO4S — CID 53017709
3-(benzenesulfonyl)-1-[(4-chlorophenyl)methyl]-4-hydroxy-2-phenyl-2H-pyrrol-5-one (PubChem CID 53017709) has the molecular formula C23H18ClNO4S and a molecular weight of 439.92 g/mol. Its IUPAC name is 3-(benzenesulfonyl)-1-[(4-chlorophenyl)methyl]-4-hydroxy-2-phenyl-2H-pyrrol-5-one.
| Compound Name | 3-(benzenesulfonyl)-1-[(4-chlorophenyl)methyl]-4-hydroxy-2-phenyl-2H-pyrrol-5-one |
|---|---|
| PubChem CID | 53017709 |
| Molecular Formula | C23H18ClNO4S |
| Molecular Weight | 439.92 g/mol |
| Exact Mass | 439.06 |
| IUPAC Name | 3-(benzenesulfonyl)-1-[(4-chlorophenyl)methyl]-4-hydroxy-2-phenyl-2H-pyrrol-5-one |
| SMILES | O=C1C(O)=C(S(=O)(=O)c2ccccc2)C(c2ccccc2)N1Cc1ccc(Cl)cc1 |
| InChI | InChI=1S/C23H18ClNO4S/c24-18-13-11-16(12-14-18)15-25-20(17-7-3-1-4-8-17)22(21(26)23(25)27)30(28,29)19-9-5-2-6-10-19/h1-14,20,26H,15H2 |
| InChIKey | AZTAYPXCODHRFD-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 74.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.92 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |