C19H20N6O4S — CID 5301806
1-(1,1-dioxothiolan-3-yl)-7,9-dimethyl-3-phenyl-4H-purino[8,7-c][1,2,4]triazine-6,8-dione (PubChem CID 5301806) has the molecular formula C19H20N6O4S and a molecular weight of 428.47 g/mol. Its IUPAC name is 1-(1,1-dioxothiolan-3-yl)-7,9-dimethyl-3-phenyl-4H-purino[8,7-c][1,2,4]triazine-6,8-dione.
| Compound Name | 1-(1,1-dioxothiolan-3-yl)-7,9-dimethyl-3-phenyl-4H-purino[8,7-c][1,2,4]triazine-6,8-dione |
|---|---|
| PubChem CID | 5301806 |
| Molecular Formula | C19H20N6O4S |
| Molecular Weight | 428.47 g/mol |
| Exact Mass | 428.13 |
| IUPAC Name | 1-(1,1-dioxothiolan-3-yl)-7,9-dimethyl-3-phenyl-4H-purino[8,7-c][1,2,4]triazine-6,8-dione |
| SMILES | Cn1c(=O)c2c(nc3n2CC(c2ccccc2)=NN3C2CCS(=O)(=O)C2)n(C)c1=O |
| InChI | InChI=1S/C19H20N6O4S/c1-22-16-15(17(26)23(2)19(22)27)24-10-14(12-6-4-3-5-7-12)21-25(18(24)20-16)13-8-9-30(28,29)11-13/h3-7,13H,8-11H2,1-2H3 |
| InChIKey | XIXWUHQJAKQVRE-UHFFFAOYSA-N |
| XLogP | -0.15 |
| TPSA | 111.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.47 |
| LogP ≤ 5 | -0.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |