C23H27N3O5S — CID 5302056
3-[[1-(benzenesulfonyl)piperidin-4-yl]amino]-1-(4-ethoxyphenyl)pyrrolidine-2,5-dione (PubChem CID 5302056) has the molecular formula C23H27N3O5S and a molecular weight of 457.55 g/mol. Its IUPAC name is 3-[[1-(benzenesulfonyl)piperidin-4-yl]amino]-1-(4-ethoxyphenyl)pyrrolidine-2,5-dione.
| Compound Name | 3-[[1-(benzenesulfonyl)piperidin-4-yl]amino]-1-(4-ethoxyphenyl)pyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 5302056 |
| Molecular Formula | C23H27N3O5S |
| Molecular Weight | 457.55 g/mol |
| Exact Mass | 457.17 |
| IUPAC Name | 3-[[1-(benzenesulfonyl)piperidin-4-yl]amino]-1-(4-ethoxyphenyl)pyrrolidine-2,5-dione |
| SMILES | CCOc1ccc(N2C(=O)CC(NC3CCN(S(=O)(=O)c4ccccc4)CC3)C2=O)cc1 |
| InChI | InChI=1S/C23H27N3O5S/c1-2-31-19-10-8-18(9-11-19)26-22(27)16-21(23(26)28)24-17-12-14-25(15-13-17)32(29,30)20-6-4-3-5-7-20/h3-11,17,21,24H,2,12-16H2,1H3 |
| InChIKey | IYWTZLGNVRONNK-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 96.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.55 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|